C15H27BO2 — CID 10354715
(4S,5S)-4,5-dicyclohexyl-2-methyl-1,3,2-dioxaborolane (PubChem CID 10354715) has the molecular formula C15H27BO2 and a molecular weight of 250.19 g/mol. Its IUPAC name is (4S,5S)-4,5-dicyclohexyl-2-methyl-1,3,2-dioxaborolane.
| Compound Name | (4S,5S)-4,5-dicyclohexyl-2-methyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10354715 |
| Molecular Formula | C15H27BO2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | (4S,5S)-4,5-dicyclohexyl-2-methyl-1,3,2-dioxaborolane |
| SMILES | CB1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C15H27BO2/c1-16-17-14(12-8-4-2-5-9-12)15(18-16)13-10-6-3-7-11-13/h12-15H,2-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | KGZVYGQSIOPUPF-GJZGRUSLSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|