C23H35BO3 — CID 135049116
(4S,5S)-4,5-dicyclohexyl-2-(1-phenylmethoxyethyl)-1,3,2-dioxaborolane (PubChem CID 135049116) has the molecular formula C23H35BO3 and a molecular weight of 370.34 g/mol. Its IUPAC name is (4S,5S)-4,5-dicyclohexyl-2-(1-phenylmethoxyethyl)-1,3,2-dioxaborolane.
| Compound Name | (4S,5S)-4,5-dicyclohexyl-2-(1-phenylmethoxyethyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135049116 |
| Molecular Formula | C23H35BO3 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (4S,5S)-4,5-dicyclohexyl-2-(1-phenylmethoxyethyl)-1,3,2-dioxaborolane |
| SMILES | CC(OCc1ccccc1)B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C23H35BO3/c1-18(25-17-19-11-5-2-6-12-19)24-26-22(20-13-7-3-8-14-20)23(27-24)21-15-9-4-10-16-21/h2,5-6,11-12,18,20-23H,3-4,7-10,13-17H2,1H3/t18?,22-,23-/m0/s1 |
| InChIKey | GKJYKRDQFMRDJJ-BFLQJQPQSA-N |
| XLogP | 5.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|