C18H33BO3 — CID 11573121
(4R,5R)-4,5-dicyclohexyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxaborolane (PubChem CID 11573121) has the molecular formula C18H33BO3 and a molecular weight of 308.27 g/mol. Its IUPAC name is (4R,5R)-4,5-dicyclohexyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-dicyclohexyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11573121 |
| Molecular Formula | C18H33BO3 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (4R,5R)-4,5-dicyclohexyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)OB1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C18H33BO3/c1-18(2,3)22-19-20-16(14-10-6-4-7-11-14)17(21-19)15-12-8-5-9-13-15/h14-17H,4-13H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | GMINXAVZPYPIFF-IAGOWNOFSA-N |
| XLogP | 4.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|