C16H29Cl3O2Si — CID 10916080
tert-butyl-dimethyl-[(1R)-2,2,2-trichloro-1-[(2R,3S)-3-cyclohexyloxiran-2-yl]ethoxy]silane (PubChem CID 10916080) has the molecular formula C16H29Cl3O2Si and a molecular weight of 387.85 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-2,2,2-trichloro-1-[(2R,3S)-3-cyclohexyloxiran-2-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R)-2,2,2-trichloro-1-[(2R,3S)-3-cyclohexyloxiran-2-yl]ethoxy]silane |
|---|---|
| PubChem CID | 10916080 |
| Molecular Formula | C16H29Cl3O2Si |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-2,2,2-trichloro-1-[(2R,3S)-3-cyclohexyloxiran-2-yl]ethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]([C@@H]1O[C@H]1C1CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H29Cl3O2Si/c1-15(2,3)22(4,5)21-14(16(17,18)19)13-12(20-13)11-9-7-6-8-10-11/h11-14H,6-10H2,1-5H3/t12-,13+,14+/m0/s1 |
| InChIKey | DMWPUEBCLOBWBH-BFHYXJOUSA-N |
| XLogP | 6.09 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|