C28H58O2S2Si2 — CID 101186688
tert-butyl-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,4-bis(cyclohexylsulfanyl)butan-2-yl]oxy-dimethylsilane (PubChem CID 101186688) has the molecular formula C28H58O2S2Si2 and a molecular weight of 547.08 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,4-bis(cyclohexylsulfanyl)butan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,4-bis(cyclohexylsulfanyl)butan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101186688 |
| Molecular Formula | C28H58O2S2Si2 |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | tert-butyl-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,4-bis(cyclohexylsulfanyl)butan-2-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CSC1CCCCC1)[C@H](CSC1CCCCC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H58O2S2Si2/c1-27(2,3)33(7,8)29-25(21-31-23-17-13-11-14-18-23)26(30-34(9,10)28(4,5)6)22-32-24-19-15-12-16-20-24/h23-26H,11-22H2,1-10H3/t25-,26-/m0/s1 |
| InChIKey | PMIHVDZMVFXIEU-UIOOFZCWSA-N |
| XLogP | 9.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|