C17H36N2O3Si — CID 67852615
[(2S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexylbutan-2-yl]carbamic acid (PubChem CID 67852615) has the molecular formula C17H36N2O3Si and a molecular weight of 344.57 g/mol. Its IUPAC name is [(2S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexylbutan-2-yl]carbamic acid.
| Compound Name | [(2S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67852615 |
| Molecular Formula | C17H36N2O3Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | [(2S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CN)[C@H](CC1CCCCC1)NC(=O)O |
| InChI | InChI=1S/C17H36N2O3Si/c1-17(2,3)23(4,5)22-15(12-18)14(19-16(20)21)11-13-9-7-6-8-10-13/h13-15,19H,6-12,18H2,1-5H3,(H,20,21)/t14-,15?/m0/s1 |
| InChIKey | XPDJPGAZPXKOGH-MLCCFXAWSA-N |
| XLogP | 3.94 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|