C42H77NO5Si2 — CID 18655448
(2R,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-(cyclopropylmethyl)-6-phenylhexanamide (PubChem CID 18655448) has the molecular formula C42H77NO5Si2 and a molecular weight of 732.25 g/mol. Its IUPAC name is (2R,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-(cyclopropylmethyl)-6-phenylhexanamide.
| Compound Name | (2R,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-(cyclopropylmethyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 18655448 |
| Molecular Formula | C42H77NO5Si2 |
| Molecular Weight | 732.25 g/mol |
| Exact Mass | 731.53 |
| IUPAC Name | (2R,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-(cyclopropylmethyl)-6-phenylhexanamide |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@H](CC1CC1)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C42H77NO5Si2/c1-30(2)25-36(44)39(45)35(27-31-19-15-13-16-20-31)43-40(46)34(26-33-23-24-33)29-38(48-50(11,12)42(6,7)8)37(28-32-21-17-14-18-22-32)47-49(9,10)41(3,4)5/h14,17-18,21-22,30-31,33-39,44-45H,13,15-16,19-20,23-29H2,1-12H3,(H,43,46)/t34-,35+,36+,37+,38-,39-/m1/s1 |
| InChIKey | ODPGGBVHXWBPCE-NPNOBJBFSA-N |
| XLogP | 10.04 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.25 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|