C29H50N2O3 — CID 70108246
(2S)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-methyl-3-[methyl(4-phenylbutyl)amino]propanamide (PubChem CID 70108246) has the molecular formula C29H50N2O3 and a molecular weight of 474.73 g/mol. Its IUPAC name is (2S)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-methyl-3-[methyl(4-phenylbutyl)amino]propanamide.
| Compound Name | (2S)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-methyl-3-[methyl(4-phenylbutyl)amino]propanamide |
|---|---|
| PubChem CID | 70108246 |
| Molecular Formula | C29H50N2O3 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.38 |
| IUPAC Name | (2S)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-methyl-3-[methyl(4-phenylbutyl)amino]propanamide |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@@H](C)CN(C)CCCCc1ccccc1 |
| InChI | InChI=1S/C29H50N2O3/c1-22(2)19-27(32)28(33)26(20-25-16-9-6-10-17-25)30-29(34)23(3)21-31(4)18-12-11-15-24-13-7-5-8-14-24/h5,7-8,13-14,22-23,25-28,32-33H,6,9-12,15-21H2,1-4H3,(H,30,34)/t23-,26-,27-,28+/m0/s1 |
| InChIKey | VIENPLMQWAWTJY-QWMXJGQVSA-N |
| XLogP | 4.80 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|