C40H59N3O6S — CID 59968519
(2S)-2-[[2-benzyl-3-[2-[benzyl(ethyl)amino]ethylsulfonyl]propanoyl]amino]-N-[(3R)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]pent-4-ynamide (PubChem CID 59968519) has the molecular formula C40H59N3O6S and a molecular weight of 709.99 g/mol. Its IUPAC name is (2S)-2-[[2-benzyl-3-[2-[benzyl(ethyl)amino]ethylsulfonyl]propanoyl]amino]-N-[(3R)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]pent-4-ynamide.
| Compound Name | (2S)-2-[[2-benzyl-3-[2-[benzyl(ethyl)amino]ethylsulfonyl]propanoyl]amino]-N-[(3R)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 59968519 |
| Molecular Formula | C40H59N3O6S |
| Molecular Weight | 709.99 g/mol |
| Exact Mass | 709.41 |
| IUPAC Name | (2S)-2-[[2-benzyl-3-[2-[benzyl(ethyl)amino]ethylsulfonyl]propanoyl]amino]-N-[(3R)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]pent-4-ynamide |
| SMILES | C#CC[C@H](NC(=O)C(Cc1ccccc1)CS(=O)(=O)CCN(CC)Cc1ccccc1)C(=O)NC(CC1CCCCC1)[C@@H](O)C(O)CC(C)C |
| InChI | InChI=1S/C40H59N3O6S/c1-5-16-35(40(47)42-36(27-32-19-12-8-13-20-32)38(45)37(44)25-30(3)4)41-39(46)34(26-31-17-10-7-11-18-31)29-50(48,49)24-23-43(6-2)28-33-21-14-9-15-22-33/h1,7,9-11,14-15,17-18,21-22,30,32,34-38,44-45H,6,8,12-13,16,19-20,23-29H2,2-4H3,(H,41,46)(H,42,47)/t34?,35-,36?,37?,38+/m0/s1 |
| InChIKey | URFZFSKOVTUDBM-NUXSVTMOSA-N |
| XLogP | 4.51 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|