C39H54N4O6S — CID 10175677
(2S)-2-[[(2S)-2-benzyl-3-[2-[benzyl(methyl)amino]ethyl-methylsulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxyhept-6-yn-2-yl]pent-4-ynamide (PubChem CID 10175677) has the molecular formula C39H54N4O6S and a molecular weight of 706.95 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-benzyl-3-[2-[benzyl(methyl)amino]ethyl-methylsulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxyhept-6-yn-2-yl]pent-4-ynamide.
| Compound Name | (2S)-2-[[(2S)-2-benzyl-3-[2-[benzyl(methyl)amino]ethyl-methylsulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxyhept-6-yn-2-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 10175677 |
| Molecular Formula | C39H54N4O6S |
| Molecular Weight | 706.95 g/mol |
| Exact Mass | 706.38 |
| IUPAC Name | (2S)-2-[[(2S)-2-benzyl-3-[2-[benzyl(methyl)amino]ethyl-methylsulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxyhept-6-yn-2-yl]pent-4-ynamide |
| SMILES | C#CC[C@H](NC(=O)[C@H](Cc1ccccc1)CS(=O)(=O)N(C)CCN(C)Cc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)CC#C |
| InChI | InChI=1S/C39H54N4O6S/c1-5-16-34(39(47)41-35(37(45)36(44)17-6-2)27-31-20-12-8-13-21-31)40-38(46)33(26-30-18-10-7-11-19-30)29-50(48,49)43(4)25-24-42(3)28-32-22-14-9-15-23-32/h1-2,7,9-11,14-15,18-19,22-23,31,33-37,44-45H,8,12-13,16-17,20-21,24-29H2,3-4H3,(H,40,46)(H,41,47)/t33-,34+,35+,36+,37-/m1/s1 |
| InChIKey | AATOWVZOPGZCHA-HSVGTTOUSA-N |
| XLogP | 2.95 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.95 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|