C37H58N4O6S — CID 10129459
(2S)-2-[[(2S)-2-benzyl-3-[2-(diethylamino)ethyl-methylsulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]pent-4-ynamide (PubChem CID 10129459) has the molecular formula C37H58N4O6S and a molecular weight of 686.96 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-benzyl-3-[2-(diethylamino)ethyl-methylsulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]pent-4-ynamide.
| Compound Name | (2S)-2-[[(2S)-2-benzyl-3-[2-(diethylamino)ethyl-methylsulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 10129459 |
| Molecular Formula | C37H58N4O6S |
| Molecular Weight | 686.96 g/mol |
| Exact Mass | 686.41 |
| IUPAC Name | (2S)-2-[[(2S)-2-benzyl-3-[2-(diethylamino)ethyl-methylsulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]pent-4-ynamide |
| SMILES | C#CCCC[C@H](O)[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@H](CC#C)NC(=O)[C@H](Cc1ccccc1)CS(=O)(=O)N(C)CCN(CC)CC |
| InChI | InChI=1S/C37H58N4O6S/c1-6-10-13-23-34(42)35(43)33(27-30-21-16-12-17-22-30)39-37(45)32(18-7-2)38-36(44)31(26-29-19-14-11-15-20-29)28-48(46,47)40(5)24-25-41(8-3)9-4/h1-2,11,14-15,19-20,30-35,42-43H,8-10,12-13,16-18,21-28H2,3-5H3,(H,38,44)(H,39,45)/t31-,32+,33+,34+,35-/m1/s1 |
| InChIKey | UEBPCWMOBKAGAW-CZBYKCICSA-N |
| XLogP | 2.94 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.96 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|