C35H52N4O5 — CID 59871333
2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-methyl-N'-[2-(methylamino)ethyl]butanediamide (PubChem CID 59871333) has the molecular formula C35H52N4O5 and a molecular weight of 608.82 g/mol. Its IUPAC name is 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-methyl-N'-[2-(methylamino)ethyl]butanediamide.
| Compound Name | 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-methyl-N'-[2-(methylamino)ethyl]butanediamide |
|---|---|
| PubChem CID | 59871333 |
| Molecular Formula | C35H52N4O5 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-methyl-N'-[2-(methylamino)ethyl]butanediamide |
| SMILES | C#CCCCC(O)[C@H](O)C(CC1CCCCC1)NC(=O)[C@H](CC#C)NC(=O)C(CC(=O)N(C)CCNC)Cc1ccccc1 |
| InChI | InChI=1S/C35H52N4O5/c1-5-7-10-20-31(40)33(42)30(24-27-18-13-9-14-19-27)38-35(44)29(15-6-2)37-34(43)28(23-26-16-11-8-12-17-26)25-32(41)39(4)22-21-36-3/h1-2,8,11-12,16-17,27-31,33,36,40,42H,7,9-10,13-15,18-25H2,3-4H3,(H,37,43)(H,38,44)/t28?,29-,30?,31?,33+/m0/s1 |
| InChIKey | CCVUZDGAVKPGSW-CCCIMSOOSA-N |
| XLogP | 2.40 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|