C36H53FN4O5 — CID 59871378
2-benzyl-N-[(2S)-1-[(1-cyclohexyl-3,4-dihydroxyoct-7-yn-2-yl)amino]-1-oxohex-5-yn-2-yl]-N'-[2-[fluoromethyl(methyl)amino]ethyl]-N'-methylbutanediamide (PubChem CID 59871378) has the molecular formula C36H53FN4O5 and a molecular weight of 640.84 g/mol. Its IUPAC name is 2-benzyl-N-[(2S)-1-[(1-cyclohexyl-3,4-dihydroxyoct-7-yn-2-yl)amino]-1-oxohex-5-yn-2-yl]-N'-[2-[fluoromethyl(methyl)amino]ethyl]-N'-methylbutanediamide.
| Compound Name | 2-benzyl-N-[(2S)-1-[(1-cyclohexyl-3,4-dihydroxyoct-7-yn-2-yl)amino]-1-oxohex-5-yn-2-yl]-N'-[2-[fluoromethyl(methyl)amino]ethyl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 59871378 |
| Molecular Formula | C36H53FN4O5 |
| Molecular Weight | 640.84 g/mol |
| Exact Mass | 640.40 |
| IUPAC Name | 2-benzyl-N-[(2S)-1-[(1-cyclohexyl-3,4-dihydroxyoct-7-yn-2-yl)amino]-1-oxohex-5-yn-2-yl]-N'-[2-[fluoromethyl(methyl)amino]ethyl]-N'-methylbutanediamide |
| SMILES | C#CCCC(O)C(O)C(CC1CCCCC1)NC(=O)[C@H](CCC#C)NC(=O)C(CC(=O)N(C)CCN(C)CF)Cc1ccccc1 |
| InChI | InChI=1S/C36H53FN4O5/c1-5-7-19-30(36(46)39-31(24-28-17-13-10-14-18-28)34(44)32(42)20-8-6-2)38-35(45)29(23-27-15-11-9-12-16-27)25-33(43)41(4)22-21-40(3)26-37/h1-2,9,11-12,15-16,28-32,34,42,44H,7-8,10,13-14,17-26H2,3-4H3,(H,38,45)(H,39,46)/t29?,30-,31?,32?,34?/m0/s1 |
| InChIKey | PCNZCRJCJAPEMD-BSPBGJTDSA-N |
| XLogP | 3.04 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|