C42H58N4O5 — CID 59871342
2-benzyl-N'-[2-[benzyl(methyl)amino]ethyl]-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-methylbutanediamide (PubChem CID 59871342) has the molecular formula C42H58N4O5 and a molecular weight of 698.95 g/mol. Its IUPAC name is 2-benzyl-N'-[2-[benzyl(methyl)amino]ethyl]-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-methylbutanediamide.
| Compound Name | 2-benzyl-N'-[2-[benzyl(methyl)amino]ethyl]-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 59871342 |
| Molecular Formula | C42H58N4O5 |
| Molecular Weight | 698.95 g/mol |
| Exact Mass | 698.44 |
| IUPAC Name | 2-benzyl-N'-[2-[benzyl(methyl)amino]ethyl]-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-methylbutanediamide |
| SMILES | C#CCCCC(O)[C@H](O)C(CC1CCCCC1)NC(=O)[C@H](CC#C)NC(=O)C(CC(=O)N(C)CCN(C)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C42H58N4O5/c1-5-7-11-25-38(47)40(49)37(29-33-21-14-9-15-22-33)44-42(51)36(18-6-2)43-41(50)35(28-32-19-12-8-13-20-32)30-39(48)46(4)27-26-45(3)31-34-23-16-10-17-24-34/h1-2,8,10,12-13,16-17,19-20,23-24,33,35-38,40,47,49H,7,9,11,14-15,18,21-22,25-31H2,3-4H3,(H,43,50)(H,44,51)/t35?,36-,37?,38?,40+/m0/s1 |
| InChIKey | FJLXBLPCGOUAIR-SOQZAVPXSA-N |
| XLogP | 4.31 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|