C40H58N4O5 — CID 59871354
2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-3-ethynyl-1-oxopent-4-yn-2-yl]-N'-[2-(diethylamino)ethyl]-N'-methylbutanediamide (PubChem CID 59871354) has the molecular formula C40H58N4O5 and a molecular weight of 674.93 g/mol. Its IUPAC name is 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-3-ethynyl-1-oxopent-4-yn-2-yl]-N'-[2-(diethylamino)ethyl]-N'-methylbutanediamide.
| Compound Name | 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-3-ethynyl-1-oxopent-4-yn-2-yl]-N'-[2-(diethylamino)ethyl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 59871354 |
| Molecular Formula | C40H58N4O5 |
| Molecular Weight | 674.93 g/mol |
| Exact Mass | 674.44 |
| IUPAC Name | 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]amino]-3-ethynyl-1-oxopent-4-yn-2-yl]-N'-[2-(diethylamino)ethyl]-N'-methylbutanediamide |
| SMILES | C#CCCCC(O)[C@H](O)C(CC1CCCCC1)NC(=O)[C@@H](NC(=O)C(CC(=O)N(C)CCN(CC)CC)Cc1ccccc1)C(C#C)C#C |
| InChI | InChI=1S/C40H58N4O5/c1-7-12-15-24-35(45)38(47)34(28-31-22-18-14-19-23-31)41-40(49)37(32(8-2)9-3)42-39(48)33(27-30-20-16-13-17-21-30)29-36(46)43(6)25-26-44(10-4)11-5/h1-3,13,16-17,20-21,31-35,37-38,45,47H,10-12,14-15,18-19,22-29H2,4-6H3,(H,41,49)(H,42,48)/t33?,34?,35?,37-,38+/m0/s1 |
| InChIKey | VCQGEGFNRQLUQH-IGPHGSPFSA-N |
| XLogP | 3.38 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|