C33H50N4O5 — CID 59932802
2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxyhex-5-en-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-[2-(dimethylamino)ethyl]-N'-methylbutanediamide (PubChem CID 59932802) has the molecular formula C33H50N4O5 and a molecular weight of 582.79 g/mol. Its IUPAC name is 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxyhex-5-en-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-[2-(dimethylamino)ethyl]-N'-methylbutanediamide.
| Compound Name | 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxyhex-5-en-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-[2-(dimethylamino)ethyl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 59932802 |
| Molecular Formula | C33H50N4O5 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | 2-benzyl-N-[(2S)-1-[[(3R)-1-cyclohexyl-3,4-dihydroxyhex-5-en-2-yl]amino]-1-oxopent-4-yn-2-yl]-N'-[2-(dimethylamino)ethyl]-N'-methylbutanediamide |
| SMILES | C#CC[C@H](NC(=O)C(CC(=O)N(C)CCN(C)C)Cc1ccccc1)C(=O)NC(CC1CCCCC1)[C@@H](O)C(O)C=C |
| InChI | InChI=1S/C33H50N4O5/c1-6-14-27(33(42)35-28(31(40)29(38)7-2)22-25-17-12-9-13-18-25)34-32(41)26(21-24-15-10-8-11-16-24)23-30(39)37(5)20-19-36(3)4/h1,7-8,10-11,15-16,25-29,31,38,40H,2,9,12-14,17-23H2,3-5H3,(H,34,41)(H,35,42)/t26?,27-,28?,29?,31+/m0/s1 |
| InChIKey | GAYZQCYHPOFSCU-JVFDYXAWSA-N |
| XLogP | 2.13 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|