C36H56N4O6S — CID 135735602
(2S)-2-[[(2R)-2-benzyl-3-[methyl-[2-(propylamino)ethyl]sulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]pent-4-ynamide (PubChem CID 135735602) has the molecular formula C36H56N4O6S and a molecular weight of 672.93 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-benzyl-3-[methyl-[2-(propylamino)ethyl]sulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]pent-4-ynamide.
| Compound Name | (2S)-2-[[(2R)-2-benzyl-3-[methyl-[2-(propylamino)ethyl]sulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 135735602 |
| Molecular Formula | C36H56N4O6S |
| Molecular Weight | 672.93 g/mol |
| Exact Mass | 672.39 |
| IUPAC Name | (2S)-2-[[(2R)-2-benzyl-3-[methyl-[2-(propylamino)ethyl]sulfamoyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxynon-8-yn-2-yl]pent-4-ynamide |
| SMILES | C#CCCC[C@H](O)[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@H](CC#C)NC(=O)[C@@H](Cc1ccccc1)CS(=O)(=O)N(C)CCNCCC |
| InChI | InChI=1S/C36H56N4O6S/c1-5-8-11-21-33(41)34(42)32(26-29-19-14-10-15-20-29)39-36(44)31(16-6-2)38-35(43)30(25-28-17-12-9-13-18-28)27-47(45,46)40(4)24-23-37-22-7-3/h1-2,9,12-13,17-18,29-34,37,41-42H,7-8,10-11,14-16,19-27H2,3-4H3,(H,38,43)(H,39,44)/t30-,31-,32-,33-,34+/m0/s1 |
| InChIKey | XXGKBPNDFDEJIF-PJRHAEEISA-N |
| XLogP | 2.60 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.93 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|