C34H52F3N3O6S — CID 162576401
(2S)-2-[[(2S)-2-benzyl-3-[2-(2,2,2-trifluoroethylamino)ethylsulfonyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]hex-5-ynamide (PubChem CID 162576401) has the molecular formula C34H52F3N3O6S and a molecular weight of 687.87 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-benzyl-3-[2-(2,2,2-trifluoroethylamino)ethylsulfonyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]hex-5-ynamide.
| Compound Name | (2S)-2-[[(2S)-2-benzyl-3-[2-(2,2,2-trifluoroethylamino)ethylsulfonyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]hex-5-ynamide |
|---|---|
| PubChem CID | 162576401 |
| Molecular Formula | C34H52F3N3O6S |
| Molecular Weight | 687.87 g/mol |
| Exact Mass | 687.35 |
| IUPAC Name | (2S)-2-[[(2S)-2-benzyl-3-[2-(2,2,2-trifluoroethylamino)ethylsulfonyl]propanoyl]amino]-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]hex-5-ynamide |
| SMILES | C#CCC[C@H](NC(=O)[C@H](Cc1ccccc1)CS(=O)(=O)CCNCC(F)(F)F)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C34H52F3N3O6S/c1-4-5-16-28(33(44)40-29(21-26-14-10-7-11-15-26)31(42)30(41)19-24(2)3)39-32(43)27(20-25-12-8-6-9-13-25)22-47(45,46)18-17-38-23-34(35,36)37/h1,6,8-9,12-13,24,26-31,38,41-42H,5,7,10-11,14-23H2,2-3H3,(H,39,43)(H,40,44)/t27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | XRNYSVQORABPGY-MOUVJORGSA-N |
| XLogP | 3.53 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|