C23H38N2O3 — CID 10408091
(2S)-2-amino-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]pent-4-enamide (PubChem CID 10408091) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is (2S)-2-amino-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]pent-4-enamide.
| Compound Name | (2S)-2-amino-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]pent-4-enamide |
|---|---|
| PubChem CID | 10408091 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (2S)-2-amino-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]pent-4-enamide |
| SMILES | C=CC[C@H](N)C(=O)N[C@@H](CCCCCc1ccccc1)[C@@H](O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C23H38N2O3/c1-4-11-19(24)23(28)25-20(22(27)21(26)16-17(2)3)15-10-6-9-14-18-12-7-5-8-13-18/h4-5,7-8,12-13,17,19-22,26-27H,1,6,9-11,14-16,24H2,2-3H3,(H,25,28)/t19-,20-,21-,22+/m0/s1 |
| InChIKey | DJGPWJMZJCCIAM-MYGLTJDJSA-N |
| XLogP | 2.95 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|