C29H48N4O7S — CID 10393741
(2S)-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]-2-[[2-(morpholin-4-ylsulfonylamino)acetyl]amino]pent-4-enamide (PubChem CID 10393741) has the molecular formula C29H48N4O7S and a molecular weight of 596.79 g/mol. Its IUPAC name is (2S)-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]-2-[[2-(morpholin-4-ylsulfonylamino)acetyl]amino]pent-4-enamide.
| Compound Name | (2S)-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]-2-[[2-(morpholin-4-ylsulfonylamino)acetyl]amino]pent-4-enamide |
|---|---|
| PubChem CID | 10393741 |
| Molecular Formula | C29H48N4O7S |
| Molecular Weight | 596.79 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | (2S)-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]-2-[[2-(morpholin-4-ylsulfonylamino)acetyl]amino]pent-4-enamide |
| SMILES | C=CC[C@H](NC(=O)CNS(=O)(=O)N1CCOCC1)C(=O)N[C@@H](CCCCCc1ccccc1)[C@@H](O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C29H48N4O7S/c1-4-11-25(31-27(35)21-30-41(38,39)33-16-18-40-19-17-33)29(37)32-24(28(36)26(34)20-22(2)3)15-10-6-9-14-23-12-7-5-8-13-23/h4-5,7-8,12-13,22,24-26,28,30,34,36H,1,6,9-11,14-21H2,2-3H3,(H,31,35)(H,32,37)/t24-,25-,26-,28+/m0/s1 |
| InChIKey | VCMCZLRICONYCZ-KJNQLLBQSA-N |
| XLogP | 1.27 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.79 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|