C36H54N4O7S — CID 10484751
(2S)-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]-2-[[(2S)-2-(morpholin-4-ylsulfonylamino)-3-phenylpropanoyl]amino]pent-4-enamide (PubChem CID 10484751) has the molecular formula C36H54N4O7S and a molecular weight of 686.92 g/mol. Its IUPAC name is (2S)-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]-2-[[(2S)-2-(morpholin-4-ylsulfonylamino)-3-phenylpropanoyl]amino]pent-4-enamide.
| Compound Name | (2S)-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]-2-[[(2S)-2-(morpholin-4-ylsulfonylamino)-3-phenylpropanoyl]amino]pent-4-enamide |
|---|---|
| PubChem CID | 10484751 |
| Molecular Formula | C36H54N4O7S |
| Molecular Weight | 686.92 g/mol |
| Exact Mass | 686.37 |
| IUPAC Name | (2S)-N-[(6S,7R,8S)-7,8-dihydroxy-10-methyl-1-phenylundecan-6-yl]-2-[[(2S)-2-(morpholin-4-ylsulfonylamino)-3-phenylpropanoyl]amino]pent-4-enamide |
| SMILES | C=CC[C@H](NC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)N1CCOCC1)C(=O)N[C@@H](CCCCCc1ccccc1)[C@@H](O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C36H54N4O7S/c1-4-14-31(38-36(44)32(26-29-18-11-6-12-19-29)39-48(45,46)40-21-23-47-24-22-40)35(43)37-30(34(42)33(41)25-27(2)3)20-13-7-10-17-28-15-8-5-9-16-28/h4-6,8-9,11-12,15-16,18-19,27,30-34,39,41-42H,1,7,10,13-14,17,20-26H2,2-3H3,(H,37,43)(H,38,44)/t30-,31-,32-,33-,34+/m0/s1 |
| InChIKey | OYRHVNUUSLYZAQ-PJRHAEEISA-N |
| XLogP | 2.88 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.92 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|