C29H42N2O3 — CID 10344489
(2S)-2-amino-N-[(2S,3R,4S)-3,4-dihydroxy-6-methyl-1-(4-naphthalen-1-ylcyclohexyl)heptan-2-yl]pent-4-enamide (PubChem CID 10344489) has the molecular formula C29H42N2O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S,3R,4S)-3,4-dihydroxy-6-methyl-1-(4-naphthalen-1-ylcyclohexyl)heptan-2-yl]pent-4-enamide.
| Compound Name | (2S)-2-amino-N-[(2S,3R,4S)-3,4-dihydroxy-6-methyl-1-(4-naphthalen-1-ylcyclohexyl)heptan-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 10344489 |
| Molecular Formula | C29H42N2O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | (2S)-2-amino-N-[(2S,3R,4S)-3,4-dihydroxy-6-methyl-1-(4-naphthalen-1-ylcyclohexyl)heptan-2-yl]pent-4-enamide |
| SMILES | C=CC[C@H](N)C(=O)N[C@@H](CC1CCC(c2cccc3ccccc23)CC1)[C@@H](O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C29H42N2O3/c1-4-8-25(30)29(34)31-26(28(33)27(32)17-19(2)3)18-20-13-15-22(16-14-20)24-12-7-10-21-9-5-6-11-23(21)24/h4-7,9-12,19-20,22,25-28,32-33H,1,8,13-18,30H2,2-3H3,(H,31,34)/t20?,22?,25-,26-,27-,28+/m0/s1 |
| InChIKey | YKBGUNDSPBVSLY-ZEZWQLSVSA-N |
| XLogP | 4.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|