C18H39NO4Si2 — CID 87421525
[(3S,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-en-3-yl]carbamic acid (PubChem CID 87421525) has the molecular formula C18H39NO4Si2 and a molecular weight of 389.69 g/mol. Its IUPAC name is [(3S,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-en-3-yl]carbamic acid.
| Compound Name | [(3S,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-en-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87421525 |
| Molecular Formula | C18H39NO4Si2 |
| Molecular Weight | 389.69 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | [(3S,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-en-3-yl]carbamic acid |
| SMILES | C=C[C@H](NC(=O)O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H39NO4Si2/c1-12-14(19-16(20)21)15(23-25(10,11)18(5,6)7)13-22-24(8,9)17(2,3)4/h12,14-15,19H,1,13H2,2-11H3,(H,20,21)/t14-,15+/m0/s1 |
| InChIKey | QQLDTXGPWXRVMP-LSDHHAIUSA-N |
| XLogP | 5.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|