C19H36N4O4Si — CID 14805099
tert-butyl (2S,4S,5S)-5-acetamido-2-azido-4-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate (PubChem CID 14805099) has the molecular formula C19H36N4O4Si and a molecular weight of 412.61 g/mol. Its IUPAC name is tert-butyl (2S,4S,5S)-5-acetamido-2-azido-4-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate.
| Compound Name | tert-butyl (2S,4S,5S)-5-acetamido-2-azido-4-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate |
|---|---|
| PubChem CID | 14805099 |
| Molecular Formula | C19H36N4O4Si |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | tert-butyl (2S,4S,5S)-5-acetamido-2-azido-4-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate |
| SMILES | C=C[C@H](NC(C)=O)[C@H](C[C@H](N=[N+]=[N-])C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36N4O4Si/c1-11-14(21-13(2)24)16(27-28(9,10)19(6,7)8)12-15(22-23-20)17(25)26-18(3,4)5/h11,14-16H,1,12H2,2-10H3,(H,21,24)/t14-,15-,16-/m0/s1 |
| InChIKey | PBZOSXKSBJRFLN-JYJNAYRXSA-N |
| XLogP | 4.48 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|