C20H38O6Si — CID 87348682
tert-butyl (2S,3S)-4-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-(prop-2-enoxymethyl)butanoate (PubChem CID 87348682) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is tert-butyl (2S,3S)-4-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-(prop-2-enoxymethyl)butanoate.
| Compound Name | tert-butyl (2S,3S)-4-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-(prop-2-enoxymethyl)butanoate |
|---|---|
| PubChem CID | 87348682 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | tert-butyl (2S,3S)-4-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-(prop-2-enoxymethyl)butanoate |
| SMILES | C=CCOCC(C(=O)OC(C)(C)C)[C@@H](COC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O6Si/c1-11-12-23-13-16(18(22)25-19(3,4)5)17(14-24-15(2)21)26-27(9,10)20(6,7)8/h11,16-17H,1,12-14H2,2-10H3/t16?,17-/m1/s1 |
| InChIKey | IMQADXQOBHWVFJ-ZYMOGRSISA-N |
| XLogP | 4.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|