C22H49NO6Si2 — CID 91455667
tert-butyl N-[(2S,3S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxypentan-3-yl]carbamate (PubChem CID 91455667) has the molecular formula C22H49NO6Si2 and a molecular weight of 479.81 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxypentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxypentan-3-yl]carbamate |
|---|---|
| PubChem CID | 91455667 |
| Molecular Formula | C22H49NO6Si2 |
| Molecular Weight | 479.81 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-dihydroxypentan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(O)CO)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H49NO6Si2/c1-20(2,3)28-19(26)23-18(16(25)14-24)17(29-31(12,13)22(7,8)9)15-27-30(10,11)21(4,5)6/h16-18,24-25H,14-15H2,1-13H3,(H,23,26)/t16?,17-,18+/m1/s1 |
| InChIKey | HRHALDIFKSOXIT-RWZMTBSZSA-N |
| XLogP | 4.65 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|