C27H60O6Si3 — CID 24828635
methyl (4S,5S,6S)-5,6,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyheptanoate (PubChem CID 24828635) has the molecular formula C27H60O6Si3 and a molecular weight of 565.03 g/mol. Its IUPAC name is methyl (4S,5S,6S)-5,6,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyheptanoate.
| Compound Name | methyl (4S,5S,6S)-5,6,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyheptanoate |
|---|---|
| PubChem CID | 24828635 |
| Molecular Formula | C27H60O6Si3 |
| Molecular Weight | 565.03 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | methyl (4S,5S,6S)-5,6,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyheptanoate |
| SMILES | COC(=O)CC[C@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H60O6Si3/c1-25(2,3)34(12,13)31-20-22(32-35(14,15)26(4,5)6)24(33-36(16,17)27(7,8)9)21(29-10)18-19-23(28)30-11/h21-22,24H,18-20H2,1-17H3/t21-,22-,24-/m0/s1 |
| InChIKey | GJVTYTWFJWBQIQ-FIXSFTCYSA-N |
| XLogP | 7.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.03 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|