C22H47NO5Si — CID 87060376
methyl 4-[[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-propan-2-ylamino]-5,5-dimethoxypentanoate (PubChem CID 87060376) has the molecular formula C22H47NO5Si and a molecular weight of 433.71 g/mol. Its IUPAC name is methyl 4-[[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-propan-2-ylamino]-5,5-dimethoxypentanoate.
| Compound Name | methyl 4-[[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-propan-2-ylamino]-5,5-dimethoxypentanoate |
|---|---|
| PubChem CID | 87060376 |
| Molecular Formula | C22H47NO5Si |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | methyl 4-[[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-propan-2-ylamino]-5,5-dimethoxypentanoate |
| SMILES | COC(=O)CCC(C(OC)OC)N(C(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C22H47NO5Si/c1-16(2)19(15-28-29(11,12)22(5,6)7)23(17(3)4)18(21(26-9)27-10)13-14-20(24)25-8/h16-19,21H,13-15H2,1-12H3/t18?,19-/m1/s1 |
| InChIKey | YWWPGNJJKLANRF-MUMRKEEXSA-N |
| XLogP | 4.68 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|