C21H46O4Si2 — CID 167430533
propan-2-yl 5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]pentanoate (PubChem CID 167430533) has the molecular formula C21H46O4Si2 and a molecular weight of 418.77 g/mol. Its IUPAC name is propan-2-yl 5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]pentanoate.
| Compound Name | propan-2-yl 5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]pentanoate |
|---|---|
| PubChem CID | 167430533 |
| Molecular Formula | C21H46O4Si2 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | propan-2-yl 5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]pentanoate |
| SMILES | CC(C)OC(=O)CCC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O4Si2/c1-17(2)25-19(22)14-13-18(15-23-26(9,10)20(3,4)5)16-24-27(11,12)21(6,7)8/h17-18H,13-16H2,1-12H3 |
| InChIKey | FUKGIUMRSFYCAW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|