C20H34O2Si — CID 14571578
(1S,4R)-4-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]cyclopent-2-en-1-ol (PubChem CID 14571578) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (1S,4R)-4-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]cyclopent-2-en-1-ol.
| Compound Name | (1S,4R)-4-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 14571578 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (1S,4R)-4-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC(C#C[C@H]1C=C[C@@H](O)C1)C1CCCCC1 |
| InChI | InChI=1S/C20H34O2Si/c1-20(2,3)23(4,5)22-19(17-9-7-6-8-10-17)14-12-16-11-13-18(21)15-16/h11,13,16-19,21H,6-10,15H2,1-5H3/t16-,18-,19?/m1/s1 |
| InChIKey | QLZNTWMMTFMTCK-SYUDBMKNSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|