C32H55F3O4Si2 — CID 22837604
(1S,2S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]-8-methyl-6-(2,2,2-trifluoroethoxy)bicyclo[4.2.0]octan-7-one (PubChem CID 22837604) has the molecular formula C32H55F3O4Si2 and a molecular weight of 616.95 g/mol. Its IUPAC name is (1S,2S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]-8-methyl-6-(2,2,2-trifluoroethoxy)bicyclo[4.2.0]octan-7-one.
| Compound Name | (1S,2S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]-8-methyl-6-(2,2,2-trifluoroethoxy)bicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 22837604 |
| Molecular Formula | C32H55F3O4Si2 |
| Molecular Weight | 616.95 g/mol |
| Exact Mass | 616.36 |
| IUPAC Name | (1S,2S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]-8-methyl-6-(2,2,2-trifluoroethoxy)bicyclo[4.2.0]octan-7-one |
| SMILES | CC1C(=O)[C@@]2(OCC(F)(F)F)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C#C[C@@H](O[Si](C)(C)C(C)(C)C)C3CCCCC3)[C@@H]12 |
| InChI | InChI=1S/C32H55F3O4Si2/c1-22-27-24(17-18-25(23-15-13-12-14-16-23)38-40(8,9)29(2,3)4)26(39-41(10,11)30(5,6)7)19-20-31(27,28(22)36)37-21-32(33,34)35/h22-27H,12-16,19-21H2,1-11H3/t22?,24-,25+,26+,27+,31+/m0/s1 |
| InChIKey | JXZUXUKDCBXXFN-HOXNJCTDSA-N |
| XLogP | 8.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.95 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|