C28H48O4Si — CID 67929726
(1'S,2'R,3'S,6'S)-2'-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]-6'-propan-2-ylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 67929726) has the molecular formula C28H48O4Si and a molecular weight of 476.77 g/mol. Its IUPAC name is (1'S,2'R,3'S,6'S)-2'-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]-6'-propan-2-ylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'S,2'R,3'S,6'S)-2'-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]-6'-propan-2-ylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 67929726 |
| Molecular Formula | C28H48O4Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | (1'S,2'R,3'S,6'S)-2'-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]-6'-propan-2-ylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CC(C)[C@@]12CC[C@H](O)[C@@H](C#C[C@@H](O[Si](C)(C)C(C)(C)C)C3CCCCC3)[C@@H]1CC21OCCO1 |
| InChI | InChI=1S/C28H48O4Si/c1-20(2)27-16-15-24(29)22(23(27)19-28(27)30-17-18-31-28)13-14-25(21-11-9-8-10-12-21)32-33(6,7)26(3,4)5/h20-25,29H,8-12,15-19H2,1-7H3/t22-,23-,24-,25+,27-/m0/s1 |
| InChIKey | VMNAQCUPSRFVMV-WOKGGPCBSA-N |
| XLogP | 6.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|