C20H30O4 — CID 67929518
(1'S,2'R,3'S,6'R)-2'-[(3S)-4-cyclopentyl-3-hydroxybut-1-ynyl]-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 67929518) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1'S,2'R,3'S,6'R)-2'-[(3S)-4-cyclopentyl-3-hydroxybut-1-ynyl]-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'S,2'R,3'S,6'R)-2'-[(3S)-4-cyclopentyl-3-hydroxybut-1-ynyl]-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 67929518 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1'S,2'R,3'S,6'R)-2'-[(3S)-4-cyclopentyl-3-hydroxybut-1-ynyl]-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | C[C@@]12CC[C@H](O)[C@@H](C#C[C@@H](O)CC3CCCC3)[C@@H]1CC21OCCO1 |
| InChI | InChI=1S/C20H30O4/c1-19-9-8-18(22)16(17(19)13-20(19)23-10-11-24-20)7-6-15(21)12-14-4-2-3-5-14/h14-18,21-22H,2-5,8-13H2,1H3/t15-,16+,17+,18+,19-/m1/s1 |
| InChIKey | NYNZBHVFIMWQNW-HVMFNXBNSA-N |
| XLogP | 2.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|