C10H18O3 — CID 135272503
(7R)-6,6-dimethyl-1,4-dioxaspiro[4.5]decan-7-ol (PubChem CID 135272503) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (7R)-6,6-dimethyl-1,4-dioxaspiro[4.5]decan-7-ol.
| Compound Name | (7R)-6,6-dimethyl-1,4-dioxaspiro[4.5]decan-7-ol |
|---|---|
| PubChem CID | 135272503 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (7R)-6,6-dimethyl-1,4-dioxaspiro[4.5]decan-7-ol |
| SMILES | CC1(C)[C@H](O)CCCC12OCCO2 |
| InChI | InChI=1S/C10H18O3/c1-9(2)8(11)4-3-5-10(9)12-6-7-13-10/h8,11H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | CZFMYOJUSUXFNR-MRVPVSSYSA-N |
| XLogP | 1.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |