About (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane
(7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane (PubChem CID 59054980) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 59054980 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C=CCCC[C@@H](CC)[C@H]1CCCC2(OCCO2)C1(C)C |
| InChI | InChI=1S/C18H32O2/c1-5-7-8-10-15(6-2)16-11-9-12-18(17(16,3)4)19-13-14-20-18/h5,15-16H,1,6-14H2,2-4H3/t15-,16-/m1/s1 |
| InChIKey | JPDDNQVYQUCIBP-HZPDHXFCSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane?
The IUPAC name of (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane (CID 59054980) is (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane is C=CCCC[C@@H](CC)[C@H]1CCCC2(OCCO2)C1(C)C.
What is the InChIKey of (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane?
The InChIKey is JPDDNQVYQUCIBP-HZPDHXFCSA-N. The full InChI is InChI=1S/C18H32O2/c1-5-7-8-10-15(6-2)16-11-9-12-18(17(16,3)4)19-13-14-20-18/h5,15-16H,1,6-14H2,2-4H3/t15-,16-/m1/s1.
What are the key properties of (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane?
(7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane has a molecular weight of 280.45 g/mol, XLogP of 4.94, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 59054980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).