C18H32O2 — CID 59054980
(7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane (PubChem CID 59054980) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 59054980 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (7R)-6,6-dimethyl-7-[(3R)-oct-7-en-3-yl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C=CCCC[C@@H](CC)[C@H]1CCCC2(OCCO2)C1(C)C |
| InChI | InChI=1S/C18H32O2/c1-5-7-8-10-15(6-2)16-11-9-12-18(17(16,3)4)19-13-14-20-18/h5,15-16H,1,6-14H2,2-4H3/t15-,16-/m1/s1 |
| InChIKey | JPDDNQVYQUCIBP-HZPDHXFCSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|