C16H34 — CID 143331368
1,1-dimethylcyclohexane;pent-1-ene;propane (PubChem CID 143331368) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is 1,1-dimethylcyclohexane;pent-1-ene;propane.
| Compound Name | 1,1-dimethylcyclohexane;pent-1-ene;propane |
|---|---|
| PubChem CID | 143331368 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 1,1-dimethylcyclohexane;pent-1-ene;propane |
| SMILES | C=CCCC.CC1(C)CCCCC1.CCC |
| InChI | InChI=1S/C8H16.C5H10.C3H8/c1-8(2)6-4-3-5-7-8;1-3-5-4-2;1-3-2/h3-7H2,1-2H3;3H,1,4-5H2,2H3;3H2,1-2H3 |
| InChIKey | AHLRHVZYNDVSTQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|