About 1,1-dimethylcyclononane
1,1-dimethylcyclononane (PubChem CID 59289773) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is 1,1-dimethylcyclononane.
Molecular Properties
| Compound Name | 1,1-dimethylcyclononane |
| PubChem CID | 59289773 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 1,1-dimethylcyclononane |
| SMILES | CC1(C)CCCCCCCC1 |
| InChI | InChI=1S/C11H22/c1-11(2)9-7-5-3-4-6-8-10-11/h3-10H2,1-2H3 |
| InChIKey | DAYIASHZGPYEIS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-dimethylcyclononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylcyclononane?
The IUPAC name of 1,1-dimethylcyclononane (CID 59289773) is 1,1-dimethylcyclononane.
What is the SMILES notation for 1,1-dimethylcyclononane?
The canonical SMILES for 1,1-dimethylcyclononane is CC1(C)CCCCCCCC1.
What is the InChIKey of 1,1-dimethylcyclononane?
The InChIKey is DAYIASHZGPYEIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22/c1-11(2)9-7-5-3-4-6-8-10-11/h3-10H2,1-2H3.
What are the key properties of 1,1-dimethylcyclononane?
1,1-dimethylcyclononane has a molecular weight of 154.30 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylcyclononane is sourced from PubChem (CID 59289773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).