C11H22 — CID 59289773
1,1-dimethylcyclononane (PubChem CID 59289773) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is 1,1-dimethylcyclononane.
| Compound Name | 1,1-dimethylcyclononane |
|---|---|
| PubChem CID | 59289773 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 1,1-dimethylcyclononane |
| SMILES | CC1(C)CCCCCCCC1 |
| InChI | InChI=1S/C11H22/c1-11(2)9-7-5-3-4-6-8-10-11/h3-10H2,1-2H3 |
| InChIKey | DAYIASHZGPYEIS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |