C8H22N2 — CID 90411117
azane;1,1-dimethylcyclohexane (PubChem CID 90411117) has the molecular formula C8H22N2 and a molecular weight of 146.28 g/mol. Its IUPAC name is azane;1,1-dimethylcyclohexane.
| Compound Name | azane;1,1-dimethylcyclohexane |
|---|---|
| PubChem CID | 90411117 |
| Molecular Formula | C8H22N2 |
| Molecular Weight | 146.28 g/mol |
| Exact Mass | 146.18 |
| IUPAC Name | azane;1,1-dimethylcyclohexane |
| SMILES | CC1(C)CCCCC1.N.N |
| InChI | InChI=1S/C8H16.2H3N/c1-8(2)6-4-3-5-7-8;;/h3-7H2,1-2H3;2*1H3 |
| InChIKey | VDIZHGMWFYOYNA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |