About azane;1,1-dimethylcyclohexane
azane;1,1-dimethylcyclohexane (PubChem CID 90411117) has the molecular formula C8H22N2
and a molecular weight of 146.28 g/mol. Its IUPAC name is azane;1,1-dimethylcyclohexane.
Molecular Properties
| Compound Name | azane;1,1-dimethylcyclohexane |
| PubChem CID | 90411117 |
| Molecular Formula | C8H22N2 |
| Molecular Weight | 146.28 g/mol |
| Exact Mass | 146.18 |
| IUPAC Name | azane;1,1-dimethylcyclohexane |
| SMILES | CC1(C)CCCCC1.N.N |
| InChI | InChI=1S/C8H16.2H3N/c1-8(2)6-4-3-5-7-8;;/h3-7H2,1-2H3;2*1H3 |
| InChIKey | VDIZHGMWFYOYNA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1,1-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,1-dimethylcyclohexane?
The IUPAC name of azane;1,1-dimethylcyclohexane (CID 90411117) is azane;1,1-dimethylcyclohexane.
What is the SMILES notation for azane;1,1-dimethylcyclohexane?
The canonical SMILES for azane;1,1-dimethylcyclohexane is CC1(C)CCCCC1.N.N.
What is the InChIKey of azane;1,1-dimethylcyclohexane?
The InChIKey is VDIZHGMWFYOYNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.2H3N/c1-8(2)6-4-3-5-7-8;;/h3-7H2,1-2H3;2*1H3.
What are the key properties of azane;1,1-dimethylcyclohexane?
azane;1,1-dimethylcyclohexane has a molecular weight of 146.28 g/mol, XLogP of 3.30, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,1-dimethylcyclohexane is sourced from PubChem (CID 90411117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).