C6H12V — CID 158712416
1,1-dimethylcyclobutane;vanadium (PubChem CID 158712416) has the molecular formula C6H12V and a molecular weight of 135.11 g/mol. Its IUPAC name is 1,1-dimethylcyclobutane;vanadium.
| Compound Name | 1,1-dimethylcyclobutane;vanadium |
|---|---|
| PubChem CID | 158712416 |
| Molecular Formula | C6H12V |
| Molecular Weight | 135.11 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 1,1-dimethylcyclobutane;vanadium |
| SMILES | CC1(C)CCC1.[V] |
| InChI | InChI=1S/C6H12.V/c1-6(2)4-3-5-6;/h3-5H2,1-2H3; |
| InChIKey | IIWWWDRFMXASIA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.11 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |