C12H25N — CID 137411495
1,6,6-trimethylazecane (PubChem CID 137411495) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 1,6,6-trimethylazecane.
| Compound Name | 1,6,6-trimethylazecane |
|---|---|
| PubChem CID | 137411495 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 1,6,6-trimethylazecane |
| SMILES | CN1CCCCC(C)(C)CCCC1 |
| InChI | InChI=1S/C12H25N/c1-12(2)8-4-6-10-13(3)11-7-5-9-12/h4-11H2,1-3H3 |
| InChIKey | XLFHAMIVIPZHBI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |