C9H21NS — CID 178113124
methanethiol;1,4,4-trimethylpiperidine (PubChem CID 178113124) has the molecular formula C9H21NS and a molecular weight of 175.34 g/mol. Its IUPAC name is methanethiol;1,4,4-trimethylpiperidine.
| Compound Name | methanethiol;1,4,4-trimethylpiperidine |
|---|---|
| PubChem CID | 178113124 |
| Molecular Formula | C9H21NS |
| Molecular Weight | 175.34 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | methanethiol;1,4,4-trimethylpiperidine |
| SMILES | CN1CCC(C)(C)CC1.CS |
| InChI | InChI=1S/C8H17N.CH4S/c1-8(2)4-6-9(3)7-5-8;1-2/h4-7H2,1-3H3;2H,1H3 |
| InChIKey | FESMJKQKVFOVAO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|