C16H27NO — CID 142009813
1-methoxy-4-methylbenzene;1,4,4-trimethylpiperidine (PubChem CID 142009813) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-methoxy-4-methylbenzene;1,4,4-trimethylpiperidine.
| Compound Name | 1-methoxy-4-methylbenzene;1,4,4-trimethylpiperidine |
|---|---|
| PubChem CID | 142009813 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 1-methoxy-4-methylbenzene;1,4,4-trimethylpiperidine |
| SMILES | CN1CCC(C)(C)CC1.COc1ccc(C)cc1 |
| InChI | InChI=1S/C8H17N.C8H10O/c1-8(2)4-6-9(3)7-5-8;1-7-3-5-8(9-2)6-4-7/h4-7H2,1-3H3;3-6H,1-2H3 |
| InChIKey | JTVBAJPUVNULAF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |