C26H29NO3 — CID 11283
View drug profile → aminoxytriphene2,3,3-tris(4-methoxyphenyl)-N,N-dimethylprop-2-en-1-amine (PubChem CID 11283) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2,3,3-tris(4-methoxyphenyl)-N,N-dimethylprop-2-en-1-amine.
| Compound Name | 2,3,3-tris(4-methoxyphenyl)-N,N-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 11283 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2,3,3-tris(4-methoxyphenyl)-N,N-dimethylprop-2-en-1-amine |
| SMILES | COc1ccc(C(CN(C)C)=C(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H29NO3/c1-27(2)18-25(19-6-12-22(28-3)13-7-19)26(20-8-14-23(29-4)15-9-20)21-10-16-24(30-5)17-11-21/h6-17H,18H2,1-5H3 |
| InChIKey | FRQGJOFRWIILCX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|