About 4-Hydroxytamoxifen
4-Hydroxytamoxifen (PubChem CID 449459) has the molecular formula C26H29NO2
and a molecular weight of 387.50 g/mol. Its IUPAC name is 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol.
Molecular Properties
| Compound Name | 4-Hydroxytamoxifen |
| PubChem CID | 449459 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| SMILES | CC/C(=C(\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)OCCN(C)C)/C3=CC=CC=C3 |
| InChI | InChI=1S/C26H29NO2/c1-4-25(20-8-6-5-7-9-20)26(21-10-14-23(28)15-11-21)22-12-16-24(17-13-22)29-19-18-27(2)3/h5-17,28H,4,18-19H2,1-3H3/b26-25- |
| InChIKey | TXUZVZSFRXZGTL-QPLCGJKRSA-N |
| XLogP | 6.80 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | 493 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-Hydroxytamoxifen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Hydroxytamoxifen?
The IUPAC name of 4-Hydroxytamoxifen (CID 449459) is 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol.
What is the SMILES notation for 4-Hydroxytamoxifen?
The canonical SMILES for 4-Hydroxytamoxifen is CC/C(=C(\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)OCCN(C)C)/C3=CC=CC=C3.
What is the InChIKey of 4-Hydroxytamoxifen?
The InChIKey is TXUZVZSFRXZGTL-QPLCGJKRSA-N. The full InChI is InChI=1S/C26H29NO2/c1-4-25(20-8-6-5-7-9-20)26(21-10-14-23(28)15-11-21)22-12-16-24(17-13-22)29-19-18-27(2)3/h5-17,28H,4,18-19H2,1-3H3/b26-25-.
What are the key properties of 4-Hydroxytamoxifen?
4-Hydroxytamoxifen has a molecular weight of 387.50 g/mol, XLogP of 6.80, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Hydroxytamoxifen is sourced from PubChem (CID 449459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).