About 2-(2-benzylphenoxy)-N,N-dimethylethanamine
2-(2-benzylphenoxy)-N,N-dimethylethanamine (PubChem CID 7077) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-(2-benzylphenoxy)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(2-benzylphenoxy)-N,N-dimethylethanamine |
| PubChem CID | 7077 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-(2-benzylphenoxy)-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO/c1-18(2)12-13-19-17-11-7-6-10-16(17)14-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3 |
| InChIKey | IZRPKIZLIFYYKR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-benzylphenoxy)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzylphenoxy)-N,N-dimethylethanamine?
The IUPAC name of 2-(2-benzylphenoxy)-N,N-dimethylethanamine (CID 7077) is 2-(2-benzylphenoxy)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(2-benzylphenoxy)-N,N-dimethylethanamine?
The canonical SMILES for 2-(2-benzylphenoxy)-N,N-dimethylethanamine is CN(C)CCOc1ccccc1Cc1ccccc1.
What is the InChIKey of 2-(2-benzylphenoxy)-N,N-dimethylethanamine?
The InChIKey is IZRPKIZLIFYYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO/c1-18(2)12-13-19-17-11-7-6-10-16(17)14-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3.
What are the key properties of 2-(2-benzylphenoxy)-N,N-dimethylethanamine?
2-(2-benzylphenoxy)-N,N-dimethylethanamine has a molecular weight of 255.36 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzylphenoxy)-N,N-dimethylethanamine is sourced from PubChem (CID 7077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).