C13H28N2 — CID 167025577
1,3,3,5,7,7-hexamethyl-1,5-diazonane (PubChem CID 167025577) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 1,3,3,5,7,7-hexamethyl-1,5-diazonane.
| Compound Name | 1,3,3,5,7,7-hexamethyl-1,5-diazonane |
|---|---|
| PubChem CID | 167025577 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1,3,3,5,7,7-hexamethyl-1,5-diazonane |
| SMILES | CN1CCC(C)(C)CN(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H28N2/c1-12(2)7-8-14(5)10-13(3,4)11-15(6)9-12/h7-11H2,1-6H3 |
| InChIKey | XSHZLRBKMUODMU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |