About 1,3,3-trimethylazepane
1,3,3-trimethylazepane (PubChem CID 18711354) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 1,3,3-trimethylazepane.
Molecular Properties
| Compound Name | 1,3,3-trimethylazepane |
| PubChem CID | 18711354 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 1,3,3-trimethylazepane |
| SMILES | CN1CCCCC(C)(C)C1 |
| InChI | InChI=1S/C9H19N/c1-9(2)6-4-5-7-10(3)8-9/h4-8H2,1-3H3 |
| InChIKey | RTMBVIAUHVXGJX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3,3-trimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,3-trimethylazepane?
The IUPAC name of 1,3,3-trimethylazepane (CID 18711354) is 1,3,3-trimethylazepane.
What is the SMILES notation for 1,3,3-trimethylazepane?
The canonical SMILES for 1,3,3-trimethylazepane is CN1CCCCC(C)(C)C1.
What is the InChIKey of 1,3,3-trimethylazepane?
The InChIKey is RTMBVIAUHVXGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N/c1-9(2)6-4-5-7-10(3)8-9/h4-8H2,1-3H3.
What are the key properties of 1,3,3-trimethylazepane?
1,3,3-trimethylazepane has a molecular weight of 141.26 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,3-trimethylazepane is sourced from PubChem (CID 18711354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).