C14H34N2 — CID 168995514
1-(1,3-dimethylazepan-3-yl)-N-methylmethanamine;ethane (PubChem CID 168995514) has the molecular formula C14H34N2 and a molecular weight of 230.44 g/mol. Its IUPAC name is 1-(1,3-dimethylazepan-3-yl)-N-methylmethanamine;ethane.
| Compound Name | 1-(1,3-dimethylazepan-3-yl)-N-methylmethanamine;ethane |
|---|---|
| PubChem CID | 168995514 |
| Molecular Formula | C14H34N2 |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 230.27 |
| IUPAC Name | 1-(1,3-dimethylazepan-3-yl)-N-methylmethanamine;ethane |
| SMILES | CC.CC.CNCC1(C)CCCCN(C)C1 |
| InChI | InChI=1S/C10H22N2.2C2H6/c1-10(8-11-2)6-4-5-7-12(3)9-10;2*1-2/h11H,4-9H2,1-3H3;2*1-2H3 |
| InChIKey | NZCGSIGCYPYTSE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |