About 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine
2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine (PubChem CID 144987620) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine.
Analyze 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine?
The IUPAC name of 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine (CID 144987620) is 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine.
What is the SMILES notation for 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine?
The canonical SMILES for 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine is CNCCC1(C)CCN(C)C1.
What is the InChIKey of 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine?
The InChIKey is UUYIQKVEEDDJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-9(4-6-10-2)5-7-11(3)8-9/h10H,4-8H2,1-3H3.
What are the key properties of 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine?
2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine has a molecular weight of 156.27 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethylpyrrolidin-3-yl)-N-methylethanamine is sourced from PubChem (CID 144987620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).