C14H31N3 — CID 107446288
N'-tert-butyl-N-[(1,4-dimethylpiperidin-4-yl)methyl]ethane-1,2-diamine (PubChem CID 107446288) has the molecular formula C14H31N3 and a molecular weight of 241.42 g/mol. Its IUPAC name is N'-tert-butyl-N-[(1,4-dimethylpiperidin-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[(1,4-dimethylpiperidin-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107446288 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | N'-tert-butyl-N-[(1,4-dimethylpiperidin-4-yl)methyl]ethane-1,2-diamine |
| SMILES | CN1CCC(C)(CNCCNC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H31N3/c1-13(2,3)16-9-8-15-12-14(4)6-10-17(5)11-7-14/h15-16H,6-12H2,1-5H3 |
| InChIKey | DEZNLMYSTZHINR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|